C17H14BrF2NO5 — CID 2388045
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3-bromophenoxy)acetate (PubChem CID 2388045) has the molecular formula C17H14BrF2NO5 and a molecular weight of 430.20 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3-bromophenoxy)acetate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3-bromophenoxy)acetate |
|---|---|
| PubChem CID | 2388045 |
| Molecular Formula | C17H14BrF2NO5 |
| Molecular Weight | 430.20 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-(3-bromophenoxy)acetate |
| SMILES | O=C(COC(=O)COc1cccc(Br)c1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H14BrF2NO5/c18-11-2-1-3-14(8-11)24-10-16(23)25-9-15(22)21-12-4-6-13(7-5-12)26-17(19)20/h1-8,17H,9-10H2,(H,21,22) |
| InChIKey | IZTVXMJUCFTZKM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.20 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |