C21H17F2NO5 — CID 8821313
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-naphthalen-2-yloxyacetate (PubChem CID 8821313) has the molecular formula C21H17F2NO5 and a molecular weight of 401.37 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-naphthalen-2-yloxyacetate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-naphthalen-2-yloxyacetate |
|---|---|
| PubChem CID | 8821313 |
| Molecular Formula | C21H17F2NO5 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-naphthalen-2-yloxyacetate |
| SMILES | O=C(COC(=O)COc1ccc2ccccc2c1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H17F2NO5/c22-21(23)29-17-9-6-16(7-10-17)24-19(25)12-28-20(26)13-27-18-8-5-14-3-1-2-4-15(14)11-18/h1-11,21H,12-13H2,(H,24,25) |
| InChIKey | NZARRARMFYGNHH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |