C18H20F2N2O2 — CID 47007122
2-[4-(difluoromethoxy)anilino]-N-(3-phenylpropyl)acetamide (PubChem CID 47007122) has the molecular formula C18H20F2N2O2 and a molecular weight of 334.37 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)anilino]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[4-(difluoromethoxy)anilino]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 47007122 |
| Molecular Formula | C18H20F2N2O2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-[4-(difluoromethoxy)anilino]-N-(3-phenylpropyl)acetamide |
| SMILES | O=C(CNc1ccc(OC(F)F)cc1)NCCCc1ccccc1 |
| InChI | InChI=1S/C18H20F2N2O2/c19-18(20)24-16-10-8-15(9-11-16)22-13-17(23)21-12-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-11,18,22H,4,7,12-13H2,(H,21,23) |
| InChIKey | XTYIQYURAFKWOY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|