C13H17F2N3O3 — CID 61258827
2-amino-N-[2-[2-[4-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl]acetamide (PubChem CID 61258827) has the molecular formula C13H17F2N3O3 and a molecular weight of 301.29 g/mol. Its IUPAC name is 2-amino-N-[2-[2-[4-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl]acetamide.
| Compound Name | 2-amino-N-[2-[2-[4-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 61258827 |
| Molecular Formula | C13H17F2N3O3 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-amino-N-[2-[2-[4-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl]acetamide |
| SMILES | NCC(=O)NCC(=O)NCCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C13H17F2N3O3/c14-13(15)21-10-3-1-9(2-4-10)5-6-17-12(20)8-18-11(19)7-16/h1-4,13H,5-8,16H2,(H,17,20)(H,18,19) |
| InChIKey | QVGNQADIWQHVII-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |