C12H16F2N2O2 — CID 63892048
4-[4-(difluoromethoxy)anilino]-N-methylbutanamide (PubChem CID 63892048) has the molecular formula C12H16F2N2O2 and a molecular weight of 258.27 g/mol. Its IUPAC name is 4-[4-(difluoromethoxy)anilino]-N-methylbutanamide.
| Compound Name | 4-[4-(difluoromethoxy)anilino]-N-methylbutanamide |
|---|---|
| PubChem CID | 63892048 |
| Molecular Formula | C12H16F2N2O2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 4-[4-(difluoromethoxy)anilino]-N-methylbutanamide |
| SMILES | CNC(=O)CCCNc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C12H16F2N2O2/c1-15-11(17)3-2-8-16-9-4-6-10(7-5-9)18-12(13)14/h4-7,12,16H,2-3,8H2,1H3,(H,15,17) |
| InChIKey | YHVDDFMFPRPTJG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|