C13H16F4N2O3 — CID 119734504
N-[2,4-bis(difluoromethoxy)phenyl]-4-(methylamino)butanamide (PubChem CID 119734504) has the molecular formula C13H16F4N2O3 and a molecular weight of 324.27 g/mol. Its IUPAC name is N-[2,4-bis(difluoromethoxy)phenyl]-4-(methylamino)butanamide.
| Compound Name | N-[2,4-bis(difluoromethoxy)phenyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119734504 |
| Molecular Formula | C13H16F4N2O3 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N-[2,4-bis(difluoromethoxy)phenyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)Nc1ccc(OC(F)F)cc1OC(F)F |
| InChI | InChI=1S/C13H16F4N2O3/c1-18-6-2-3-11(20)19-9-5-4-8(21-12(14)15)7-10(9)22-13(16)17/h4-5,7,12-13,18H,2-3,6H2,1H3,(H,19,20) |
| InChIKey | HFYDFZPFICIZGC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|