C13H15F2NO5 — CID 60940435
5-[2-(difluoromethoxy)-5-methoxyanilino]-5-oxopentanoic acid (PubChem CID 60940435) has the molecular formula C13H15F2NO5 and a molecular weight of 303.26 g/mol. Its IUPAC name is 5-[2-(difluoromethoxy)-5-methoxyanilino]-5-oxopentanoic acid.
| Compound Name | 5-[2-(difluoromethoxy)-5-methoxyanilino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 60940435 |
| Molecular Formula | C13H15F2NO5 |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 5-[2-(difluoromethoxy)-5-methoxyanilino]-5-oxopentanoic acid |
| SMILES | COc1ccc(OC(F)F)c(NC(=O)CCCC(=O)O)c1 |
| InChI | InChI=1S/C13H15F2NO5/c1-20-8-5-6-10(21-13(14)15)9(7-8)16-11(17)3-2-4-12(18)19/h5-7,13H,2-4H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | ULVFRDIIJZPKBA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |