C13H16BrF2NO3 — CID 43698620
2-bromo-N-[2-(difluoromethoxy)-5-methoxyphenyl]-3-methylbutanamide (PubChem CID 43698620) has the molecular formula C13H16BrF2NO3 and a molecular weight of 352.18 g/mol. Its IUPAC name is 2-bromo-N-[2-(difluoromethoxy)-5-methoxyphenyl]-3-methylbutanamide.
| Compound Name | 2-bromo-N-[2-(difluoromethoxy)-5-methoxyphenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 43698620 |
| Molecular Formula | C13H16BrF2NO3 |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 2-bromo-N-[2-(difluoromethoxy)-5-methoxyphenyl]-3-methylbutanamide |
| SMILES | COc1ccc(OC(F)F)c(NC(=O)C(Br)C(C)C)c1 |
| InChI | InChI=1S/C13H16BrF2NO3/c1-7(2)11(14)12(18)17-9-6-8(19-3)4-5-10(9)20-13(15)16/h4-7,11,13H,1-3H3,(H,17,18) |
| InChIKey | YSRGNCRMNBOQIU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|