C11H12BrF2NO3 — CID 107903735
2-bromo-N-[2-(difluoromethoxy)-5-methoxyphenyl]propanamide (PubChem CID 107903735) has the molecular formula C11H12BrF2NO3 and a molecular weight of 324.12 g/mol. Its IUPAC name is 2-bromo-N-[2-(difluoromethoxy)-5-methoxyphenyl]propanamide.
| Compound Name | 2-bromo-N-[2-(difluoromethoxy)-5-methoxyphenyl]propanamide |
|---|---|
| PubChem CID | 107903735 |
| Molecular Formula | C11H12BrF2NO3 |
| Molecular Weight | 324.12 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 2-bromo-N-[2-(difluoromethoxy)-5-methoxyphenyl]propanamide |
| SMILES | COc1ccc(OC(F)F)c(NC(=O)C(C)Br)c1 |
| InChI | InChI=1S/C11H12BrF2NO3/c1-6(12)10(16)15-8-5-7(17-2)3-4-9(8)18-11(13)14/h3-6,11H,1-2H3,(H,15,16) |
| InChIKey | LYPDMTKIUTYXRK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.12 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|