C14H18F2N2O5 — CID 122006058
4-[[2-(difluoromethoxy)-5-methoxyphenyl]methylcarbamoylamino]butanoic acid (PubChem CID 122006058) has the molecular formula C14H18F2N2O5 and a molecular weight of 332.30 g/mol. Its IUPAC name is 4-[[2-(difluoromethoxy)-5-methoxyphenyl]methylcarbamoylamino]butanoic acid.
| Compound Name | 4-[[2-(difluoromethoxy)-5-methoxyphenyl]methylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122006058 |
| Molecular Formula | C14H18F2N2O5 |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 4-[[2-(difluoromethoxy)-5-methoxyphenyl]methylcarbamoylamino]butanoic acid |
| SMILES | COc1ccc(OC(F)F)c(CNC(=O)NCCCC(=O)O)c1 |
| InChI | InChI=1S/C14H18F2N2O5/c1-22-10-4-5-11(23-13(15)16)9(7-10)8-18-14(21)17-6-2-3-12(19)20/h4-5,7,13H,2-3,6,8H2,1H3,(H,19,20)(H2,17,18,21) |
| InChIKey | BOAQYQAMRDZGDY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|