C14H20F2N2O4 — CID 119816348
N-[[2-(difluoromethoxy)-5-methoxyphenyl]methyl]-2-(2-methoxyethylamino)acetamide (PubChem CID 119816348) has the molecular formula C14H20F2N2O4 and a molecular weight of 318.32 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)-5-methoxyphenyl]methyl]-2-(2-methoxyethylamino)acetamide.
| Compound Name | N-[[2-(difluoromethoxy)-5-methoxyphenyl]methyl]-2-(2-methoxyethylamino)acetamide |
|---|---|
| PubChem CID | 119816348 |
| Molecular Formula | C14H20F2N2O4 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-[[2-(difluoromethoxy)-5-methoxyphenyl]methyl]-2-(2-methoxyethylamino)acetamide |
| SMILES | COCCNCC(=O)NCc1cc(OC)ccc1OC(F)F |
| InChI | InChI=1S/C14H20F2N2O4/c1-20-6-5-17-9-13(19)18-8-10-7-11(21-2)3-4-12(10)22-14(15)16/h3-4,7,14,17H,5-6,8-9H2,1-2H3,(H,18,19) |
| InChIKey | OLUQNBWNMYHBLW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|