C15H22F2N2O3 — CID 119816354
(2S)-2-amino-N-[[2-(difluoromethoxy)-5-methoxyphenyl]methyl]-4-methylpentanamide (PubChem CID 119816354) has the molecular formula C15H22F2N2O3 and a molecular weight of 316.35 g/mol. Its IUPAC name is (2S)-2-amino-N-[[2-(difluoromethoxy)-5-methoxyphenyl]methyl]-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-[[2-(difluoromethoxy)-5-methoxyphenyl]methyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 119816354 |
| Molecular Formula | C15H22F2N2O3 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (2S)-2-amino-N-[[2-(difluoromethoxy)-5-methoxyphenyl]methyl]-4-methylpentanamide |
| SMILES | COc1ccc(OC(F)F)c(CNC(=O)[C@@H](N)CC(C)C)c1 |
| InChI | InChI=1S/C15H22F2N2O3/c1-9(2)6-12(18)14(20)19-8-10-7-11(21-3)4-5-13(10)22-15(16)17/h4-5,7,9,12,15H,6,8,18H2,1-3H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | NGHZVYCDBYTSNE-LBPRGKRZSA-N |
| XLogP | 2.29 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |