C11H14BrClF2N2O2 — CID 119313626
(2S)-2-amino-N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]propanamide;hydrochloride (PubChem CID 119313626) has the molecular formula C11H14BrClF2N2O2 and a molecular weight of 359.60 g/mol. Its IUPAC name is (2S)-2-amino-N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]propanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119313626 |
| Molecular Formula | C11H14BrClF2N2O2 |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | (2S)-2-amino-N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]propanamide;hydrochloride |
| SMILES | C[C@H](N)C(=O)NCc1cc(Br)ccc1OC(F)F.Cl |
| InChI | InChI=1S/C11H13BrF2N2O2.ClH/c1-6(15)10(17)16-5-7-4-8(12)2-3-9(7)18-11(13)14;/h2-4,6,11H,5,15H2,1H3,(H,16,17);1H/t6-;/m0./s1 |
| InChIKey | VYCJLWVAPZPCNS-RGMNGODLSA-N |
| XLogP | 2.44 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |