C11H13BrF2N2O2 — CID 43232569
2-[[5-bromo-2-(difluoromethoxy)phenyl]methylamino]propanamide (PubChem CID 43232569) has the molecular formula C11H13BrF2N2O2 and a molecular weight of 323.14 g/mol. Its IUPAC name is 2-[[5-bromo-2-(difluoromethoxy)phenyl]methylamino]propanamide.
| Compound Name | 2-[[5-bromo-2-(difluoromethoxy)phenyl]methylamino]propanamide |
|---|---|
| PubChem CID | 43232569 |
| Molecular Formula | C11H13BrF2N2O2 |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 2-[[5-bromo-2-(difluoromethoxy)phenyl]methylamino]propanamide |
| SMILES | CC(NCc1cc(Br)ccc1OC(F)F)C(N)=O |
| InChI | InChI=1S/C11H13BrF2N2O2/c1-6(10(15)17)16-5-7-4-8(12)2-3-9(7)18-11(13)14/h2-4,6,11,16H,5H2,1H3,(H2,15,17) |
| InChIKey | PVKTXZDGRYXTRT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |