C12H14F4N2O3 — CID 43402355
2-[[2,4-bis(difluoromethoxy)phenyl]methylamino]propanamide (PubChem CID 43402355) has the molecular formula C12H14F4N2O3 and a molecular weight of 310.25 g/mol. Its IUPAC name is 2-[[2,4-bis(difluoromethoxy)phenyl]methylamino]propanamide.
| Compound Name | 2-[[2,4-bis(difluoromethoxy)phenyl]methylamino]propanamide |
|---|---|
| PubChem CID | 43402355 |
| Molecular Formula | C12H14F4N2O3 |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-[[2,4-bis(difluoromethoxy)phenyl]methylamino]propanamide |
| SMILES | CC(NCc1ccc(OC(F)F)cc1OC(F)F)C(N)=O |
| InChI | InChI=1S/C12H14F4N2O3/c1-6(10(17)19)18-5-7-2-3-8(20-11(13)14)4-9(7)21-12(15)16/h2-4,6,11-12,18H,5H2,1H3,(H2,17,19) |
| InChIKey | ITMDCAICVJLQFM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |