C14H14F4N2O4 — CID 134045681
2-[[(E)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]amino]propanamide (PubChem CID 134045681) has the molecular formula C14H14F4N2O4 and a molecular weight of 350.27 g/mol. Its IUPAC name is 2-[[(E)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]amino]propanamide.
| Compound Name | 2-[[(E)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]amino]propanamide |
|---|---|
| PubChem CID | 134045681 |
| Molecular Formula | C14H14F4N2O4 |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 2-[[(E)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]amino]propanamide |
| SMILES | CC(NC(=O)/C=C/c1ccc(OC(F)F)cc1OC(F)F)C(N)=O |
| InChI | InChI=1S/C14H14F4N2O4/c1-7(12(19)22)20-11(21)5-3-8-2-4-9(23-13(15)16)6-10(8)24-14(17)18/h2-7,13-14H,1H3,(H2,19,22)(H,20,21)/b5-3+ |
| InChIKey | HEJSKOQXHJDNIH-HWKANZROSA-N |
| XLogP | 1.89 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|