C15H16F4N2O4 — CID 9480899
(E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[2-(dimethylamino)-2-oxoethyl]prop-2-enamide (PubChem CID 9480899) has the molecular formula C15H16F4N2O4 and a molecular weight of 364.30 g/mol. Its IUPAC name is (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[2-(dimethylamino)-2-oxoethyl]prop-2-enamide.
| Compound Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[2-(dimethylamino)-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9480899 |
| Molecular Formula | C15H16F4N2O4 |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[2-(dimethylamino)-2-oxoethyl]prop-2-enamide |
| SMILES | CN(C)C(=O)CNC(=O)/C=C/c1ccc(OC(F)F)cc1OC(F)F |
| InChI | InChI=1S/C15H16F4N2O4/c1-21(2)13(23)8-20-12(22)6-4-9-3-5-10(24-14(16)17)7-11(9)25-15(18)19/h3-7,14-15H,8H2,1-2H3,(H,20,22)/b6-4+ |
| InChIKey | SJSYELPOMBEBOQ-GQCTYLIASA-N |
| XLogP | 2.11 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|