C19H17F4NO3 — CID 9105021
(E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[(2-methylphenyl)methyl]prop-2-enamide (PubChem CID 9105021) has the molecular formula C19H17F4NO3 and a molecular weight of 383.34 g/mol. Its IUPAC name is (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[(2-methylphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[(2-methylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 9105021 |
| Molecular Formula | C19H17F4NO3 |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[(2-methylphenyl)methyl]prop-2-enamide |
| SMILES | Cc1ccccc1CNC(=O)/C=C/c1ccc(OC(F)F)cc1OC(F)F |
| InChI | InChI=1S/C19H17F4NO3/c1-12-4-2-3-5-14(12)11-24-17(25)9-7-13-6-8-15(26-18(20)21)10-16(13)27-19(22)23/h2-10,18-19H,11H2,1H3,(H,24,25)/b9-7+ |
| InChIKey | DICYRRXRQUEIMC-VQHVLOKHSA-N |
| XLogP | 4.53 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|