C18H13BrF4N2O4 — CID 30856096
N'-[(E)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]-2-bromobenzohydrazide (PubChem CID 30856096) has the molecular formula C18H13BrF4N2O4 and a molecular weight of 477.21 g/mol. Its IUPAC name is N'-[(E)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]-2-bromobenzohydrazide.
| Compound Name | N'-[(E)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]-2-bromobenzohydrazide |
|---|---|
| PubChem CID | 30856096 |
| Molecular Formula | C18H13BrF4N2O4 |
| Molecular Weight | 477.21 g/mol |
| Exact Mass | 476.00 |
| IUPAC Name | N'-[(E)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]-2-bromobenzohydrazide |
| SMILES | O=C(/C=C/c1ccc(OC(F)F)cc1OC(F)F)NNC(=O)c1ccccc1Br |
| InChI | InChI=1S/C18H13BrF4N2O4/c19-13-4-2-1-3-12(13)16(27)25-24-15(26)8-6-10-5-7-11(28-17(20)21)9-14(10)29-18(22)23/h1-9,17-18H,(H,24,26)(H,25,27)/b8-6+ |
| InChIKey | FFIPNYLLEQFHFR-SOFGYWHQSA-N |
| XLogP | 4.13 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.21 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|