C20H19F4NO5 — CID 30847487
(E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-(4,5-dimethoxy-2-methylphenyl)prop-2-enamide (PubChem CID 30847487) has the molecular formula C20H19F4NO5 and a molecular weight of 429.37 g/mol. Its IUPAC name is (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-(4,5-dimethoxy-2-methylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-(4,5-dimethoxy-2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 30847487 |
| Molecular Formula | C20H19F4NO5 |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-(4,5-dimethoxy-2-methylphenyl)prop-2-enamide |
| SMILES | COc1cc(C)c(NC(=O)/C=C/c2ccc(OC(F)F)cc2OC(F)F)cc1OC |
| InChI | InChI=1S/C20H19F4NO5/c1-11-8-16(27-2)17(28-3)10-14(11)25-18(26)7-5-12-4-6-13(29-19(21)22)9-15(12)30-20(23)24/h4-10,19-20H,1-3H3,(H,25,26)/b7-5+ |
| InChIKey | IMOOWFRYLYIZLE-FNORWQNLSA-N |
| XLogP | 4.87 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|