C20H15F4N3O4 — CID 55766125
(E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]prop-2-enamide (PubChem CID 55766125) has the molecular formula C20H15F4N3O4 and a molecular weight of 437.35 g/mol. Its IUPAC name is (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55766125 |
| Molecular Formula | C20H15F4N3O4 |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]prop-2-enamide |
| SMILES | Cc1nc(-c2ccccc2NC(=O)/C=C/c2ccc(OC(F)F)cc2OC(F)F)no1 |
| InChI | InChI=1S/C20H15F4N3O4/c1-11-25-18(27-31-11)14-4-2-3-5-15(14)26-17(28)9-7-12-6-8-13(29-19(21)22)10-16(12)30-20(23)24/h2-10,19-20H,1H3,(H,26,28)/b9-7+ |
| InChIKey | RBDSVYFRPYAGGG-VQHVLOKHSA-N |
| XLogP | 4.90 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|