C19H15F4N5O3 — CID 41359971
(E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[3-(1-methyltetrazol-5-yl)phenyl]prop-2-enamide (PubChem CID 41359971) has the molecular formula C19H15F4N5O3 and a molecular weight of 437.35 g/mol. Its IUPAC name is (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[3-(1-methyltetrazol-5-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[3-(1-methyltetrazol-5-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 41359971 |
| Molecular Formula | C19H15F4N5O3 |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[3-(1-methyltetrazol-5-yl)phenyl]prop-2-enamide |
| SMILES | Cn1nnnc1-c1cccc(NC(=O)/C=C/c2ccc(OC(F)F)cc2OC(F)F)c1 |
| InChI | InChI=1S/C19H15F4N5O3/c1-28-17(25-26-27-28)12-3-2-4-13(9-12)24-16(29)8-6-11-5-7-14(30-18(20)21)10-15(11)31-19(22)23/h2-10,18-19H,1H3,(H,24,29)/b8-6+ |
| InChIKey | XQXONYKUUBCGKF-SOFGYWHQSA-N |
| XLogP | 3.73 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|