C21H24N6O3 — CID 46700138
4-methoxy-N-[3-methyl-1-[3-(1-methyltetrazol-5-yl)anilino]-1-oxobutan-2-yl]benzamide (PubChem CID 46700138) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is 4-methoxy-N-[3-methyl-1-[3-(1-methyltetrazol-5-yl)anilino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-methoxy-N-[3-methyl-1-[3-(1-methyltetrazol-5-yl)anilino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 46700138 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 4-methoxy-N-[3-methyl-1-[3-(1-methyltetrazol-5-yl)anilino]-1-oxobutan-2-yl]benzamide |
| SMILES | COc1ccc(C(=O)NC(C(=O)Nc2cccc(-c3nnnn3C)c2)C(C)C)cc1 |
| InChI | InChI=1S/C21H24N6O3/c1-13(2)18(23-20(28)14-8-10-17(30-4)11-9-14)21(29)22-16-7-5-6-15(12-16)19-24-25-26-27(19)3/h5-13,18H,1-4H3,(H,22,29)(H,23,28) |
| InChIKey | ACGZBPVPIBOYIV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |