C20H19N7O2 — CID 136524555
1-[(4-methoxyphenyl)methyl]-N-[3-(1-methyltetrazol-5-yl)phenyl]pyrazole-4-carboxamide (PubChem CID 136524555) has the molecular formula C20H19N7O2 and a molecular weight of 389.42 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-N-[3-(1-methyltetrazol-5-yl)phenyl]pyrazole-4-carboxamide.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-N-[3-(1-methyltetrazol-5-yl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 136524555 |
| Molecular Formula | C20H19N7O2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-N-[3-(1-methyltetrazol-5-yl)phenyl]pyrazole-4-carboxamide |
| SMILES | COc1ccc(Cn2cc(C(=O)Nc3cccc(-c4nnnn4C)c3)cn2)cc1 |
| InChI | InChI=1S/C20H19N7O2/c1-26-19(23-24-25-26)15-4-3-5-17(10-15)22-20(28)16-11-21-27(13-16)12-14-6-8-18(29-2)9-7-14/h3-11,13H,12H2,1-2H3,(H,22,28) |
| InChIKey | URSXAQZYALHAAR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |