C14H10Cl2N6O — CID 51304309
5,6-dichloro-N-[3-(1-methyltetrazol-5-yl)phenyl]pyridine-3-carboxamide (PubChem CID 51304309) has the molecular formula C14H10Cl2N6O and a molecular weight of 349.18 g/mol. Its IUPAC name is 5,6-dichloro-N-[3-(1-methyltetrazol-5-yl)phenyl]pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-[3-(1-methyltetrazol-5-yl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 51304309 |
| Molecular Formula | C14H10Cl2N6O |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 5,6-dichloro-N-[3-(1-methyltetrazol-5-yl)phenyl]pyridine-3-carboxamide |
| SMILES | Cn1nnnc1-c1cccc(NC(=O)c2cnc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C14H10Cl2N6O/c1-22-13(19-20-21-22)8-3-2-4-10(5-8)18-14(23)9-6-11(15)12(16)17-7-9/h2-7H,1H3,(H,18,23) |
| InChIKey | RRPPJMNDZCGCFP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|