C15H13ClN6O3S — CID 41357033
4-chloro-N-[3-(1-methyltetrazol-5-yl)phenyl]-3-sulfamoylbenzamide (PubChem CID 41357033) has the molecular formula C15H13ClN6O3S and a molecular weight of 392.83 g/mol. Its IUPAC name is 4-chloro-N-[3-(1-methyltetrazol-5-yl)phenyl]-3-sulfamoylbenzamide.
| Compound Name | 4-chloro-N-[3-(1-methyltetrazol-5-yl)phenyl]-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 41357033 |
| Molecular Formula | C15H13ClN6O3S |
| Molecular Weight | 392.83 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 4-chloro-N-[3-(1-methyltetrazol-5-yl)phenyl]-3-sulfamoylbenzamide |
| SMILES | Cn1nnnc1-c1cccc(NC(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)c1 |
| InChI | InChI=1S/C15H13ClN6O3S/c1-22-14(19-20-21-22)9-3-2-4-11(7-9)18-15(23)10-5-6-12(16)13(8-10)26(17,24)25/h2-8H,1H3,(H,18,23)(H2,17,24,25) |
| InChIKey | BKUJJEQGTJWDCW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.83 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |