C21H18N4OS — CID 9324775
1-benzyl-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]pyrazole-4-carboxamide (PubChem CID 9324775) has the molecular formula C21H18N4OS and a molecular weight of 374.47 g/mol. Its IUPAC name is 1-benzyl-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]pyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 9324775 |
| Molecular Formula | C21H18N4OS |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 1-benzyl-N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]pyrazole-4-carboxamide |
| SMILES | Cc1nc(-c2cccc(NC(=O)c3cnn(Cc4ccccc4)c3)c2)cs1 |
| InChI | InChI=1S/C21H18N4OS/c1-15-23-20(14-27-15)17-8-5-9-19(10-17)24-21(26)18-11-22-25(13-18)12-16-6-3-2-4-7-16/h2-11,13-14H,12H2,1H3,(H,24,26) |
| InChIKey | NZHJYAFXVLYLPZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |