C19H15N3O — CID 46540728
1-benzyl-N-(3-ethynylphenyl)pyrazole-4-carboxamide (PubChem CID 46540728) has the molecular formula C19H15N3O and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-benzyl-N-(3-ethynylphenyl)pyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-(3-ethynylphenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46540728 |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-benzyl-N-(3-ethynylphenyl)pyrazole-4-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)c2cnn(Cc3ccccc3)c2)c1 |
| InChI | InChI=1S/C19H15N3O/c1-2-15-9-6-10-18(11-15)21-19(23)17-12-20-22(14-17)13-16-7-4-3-5-8-16/h1,3-12,14H,13H2,(H,21,23) |
| InChIKey | KAJJMSGKSQYUME-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|