C18H14F4N2O4 — CID 8571908
4-[[(E)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]amino]benzamide (PubChem CID 8571908) has the molecular formula C18H14F4N2O4 and a molecular weight of 398.31 g/mol. Its IUPAC name is 4-[[(E)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]amino]benzamide.
| Compound Name | 4-[[(E)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 8571908 |
| Molecular Formula | C18H14F4N2O4 |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 4-[[(E)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)/C=C/c2ccc(OC(F)F)cc2OC(F)F)cc1 |
| InChI | InChI=1S/C18H14F4N2O4/c19-17(20)27-13-7-3-10(14(9-13)28-18(21)22)4-8-15(25)24-12-5-1-11(2-6-12)16(23)26/h1-9,17-18H,(H2,23,26)(H,24,25)/b8-4+ |
| InChIKey | QREFGUWDAKWQBD-XBXARRHUSA-N |
| XLogP | 3.64 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|