C19H18F4N2O5 — CID 55635307
(E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[6-(2-methoxyethoxy)-3-pyridinyl]prop-2-enamide (PubChem CID 55635307) has the molecular formula C19H18F4N2O5 and a molecular weight of 430.35 g/mol. Its IUPAC name is (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[6-(2-methoxyethoxy)-3-pyridinyl]prop-2-enamide.
| Compound Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[6-(2-methoxyethoxy)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 55635307 |
| Molecular Formula | C19H18F4N2O5 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-N-[6-(2-methoxyethoxy)-3-pyridinyl]prop-2-enamide |
| SMILES | COCCOc1ccc(NC(=O)/C=C/c2ccc(OC(F)F)cc2OC(F)F)cn1 |
| InChI | InChI=1S/C19H18F4N2O5/c1-27-8-9-28-17-7-4-13(11-24-17)25-16(26)6-3-12-2-5-14(29-18(20)21)10-15(12)30-19(22)23/h2-7,10-11,18-19H,8-9H2,1H3,(H,25,26)/b6-3+ |
| InChIKey | NMIXMQVJSXVVTM-ZZXKWVIFSA-N |
| XLogP | 3.96 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|