C15H14F2N2O3 — CID 33142873
2-[4-(difluoromethoxy)phenyl]-N-(6-methoxy-3-pyridinyl)acetamide (PubChem CID 33142873) has the molecular formula C15H14F2N2O3 and a molecular weight of 308.28 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)phenyl]-N-(6-methoxy-3-pyridinyl)acetamide.
| Compound Name | 2-[4-(difluoromethoxy)phenyl]-N-(6-methoxy-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 33142873 |
| Molecular Formula | C15H14F2N2O3 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-[4-(difluoromethoxy)phenyl]-N-(6-methoxy-3-pyridinyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cc2ccc(OC(F)F)cc2)cn1 |
| InChI | InChI=1S/C15H14F2N2O3/c1-21-14-7-4-11(9-18-14)19-13(20)8-10-2-5-12(6-3-10)22-15(16)17/h2-7,9,15H,8H2,1H3,(H,19,20) |
| InChIKey | AYOQTGCPZZNOGO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |