C11H12F4N2O3 — CID 103732741
2,2,3,3-tetrafluoro-N-[6-(2-methoxyethoxy)-3-pyridinyl]propanamide (PubChem CID 103732741) has the molecular formula C11H12F4N2O3 and a molecular weight of 296.22 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[6-(2-methoxyethoxy)-3-pyridinyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[6-(2-methoxyethoxy)-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 103732741 |
| Molecular Formula | C11H12F4N2O3 |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[6-(2-methoxyethoxy)-3-pyridinyl]propanamide |
| SMILES | COCCOc1ccc(NC(=O)C(F)(F)C(F)F)cn1 |
| InChI | InChI=1S/C11H12F4N2O3/c1-19-4-5-20-8-3-2-7(6-16-8)17-10(18)11(14,15)9(12)13/h2-3,6,9H,4-5H2,1H3,(H,17,18) |
| InChIKey | RLRMLULOOZKMGM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|