C11H17N3O3 — CID 43704151
N-[6-(2-methoxyethoxy)-3-pyridinyl]-2-(methylamino)acetamide (PubChem CID 43704151) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is N-[6-(2-methoxyethoxy)-3-pyridinyl]-2-(methylamino)acetamide.
| Compound Name | N-[6-(2-methoxyethoxy)-3-pyridinyl]-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 43704151 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-[6-(2-methoxyethoxy)-3-pyridinyl]-2-(methylamino)acetamide |
| SMILES | CNCC(=O)Nc1ccc(OCCOC)nc1 |
| InChI | InChI=1S/C11H17N3O3/c1-12-8-10(15)14-9-3-4-11(13-7-9)17-6-5-16-2/h3-4,7,12H,5-6,8H2,1-2H3,(H,14,15) |
| InChIKey | LKSJUAJMTKHGGF-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|