C12H16BrN3O3 — CID 52910218
1-(2-bromoprop-2-enyl)-3-[6-(2-methoxyethoxy)-3-pyridinyl]urea (PubChem CID 52910218) has the molecular formula C12H16BrN3O3 and a molecular weight of 330.18 g/mol. Its IUPAC name is 1-(2-bromoprop-2-enyl)-3-[6-(2-methoxyethoxy)-3-pyridinyl]urea.
| Compound Name | 1-(2-bromoprop-2-enyl)-3-[6-(2-methoxyethoxy)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 52910218 |
| Molecular Formula | C12H16BrN3O3 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 1-(2-bromoprop-2-enyl)-3-[6-(2-methoxyethoxy)-3-pyridinyl]urea |
| SMILES | C=C(Br)CNC(=O)Nc1ccc(OCCOC)nc1 |
| InChI | InChI=1S/C12H16BrN3O3/c1-9(13)7-15-12(17)16-10-3-4-11(14-8-10)19-6-5-18-2/h3-4,8H,1,5-7H2,2H3,(H2,15,16,17) |
| InChIKey | ZGPFDONYRFGUDT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|