C17H25N5O3 — CID 95045418
1-[6-(2-methoxyethoxy)-3-pyridinyl]-3-[(2S)-2-methyl-3-(2-methylimidazol-1-yl)propyl]urea (PubChem CID 95045418) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-[6-(2-methoxyethoxy)-3-pyridinyl]-3-[(2S)-2-methyl-3-(2-methylimidazol-1-yl)propyl]urea.
| Compound Name | 1-[6-(2-methoxyethoxy)-3-pyridinyl]-3-[(2S)-2-methyl-3-(2-methylimidazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 95045418 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1-[6-(2-methoxyethoxy)-3-pyridinyl]-3-[(2S)-2-methyl-3-(2-methylimidazol-1-yl)propyl]urea |
| SMILES | COCCOc1ccc(NC(=O)NC[C@H](C)Cn2ccnc2C)cn1 |
| InChI | InChI=1S/C17H25N5O3/c1-13(12-22-7-6-18-14(22)2)10-20-17(23)21-15-4-5-16(19-11-15)25-9-8-24-3/h4-7,11,13H,8-10,12H2,1-3H3,(H2,20,21,23)/t13-/m0/s1 |
| InChIKey | JMKPZKCRPVAEIK-ZDUSSCGKSA-N |
| XLogP | 2.07 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|