C15H21N5O3 — CID 94683249
1-[(2S)-1-imidazol-1-ylpropan-2-yl]-3-[6-(2-methoxyethoxy)-3-pyridinyl]urea (PubChem CID 94683249) has the molecular formula C15H21N5O3 and a molecular weight of 319.37 g/mol. Its IUPAC name is 1-[(2S)-1-imidazol-1-ylpropan-2-yl]-3-[6-(2-methoxyethoxy)-3-pyridinyl]urea.
| Compound Name | 1-[(2S)-1-imidazol-1-ylpropan-2-yl]-3-[6-(2-methoxyethoxy)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 94683249 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 1-[(2S)-1-imidazol-1-ylpropan-2-yl]-3-[6-(2-methoxyethoxy)-3-pyridinyl]urea |
| SMILES | COCCOc1ccc(NC(=O)N[C@@H](C)Cn2ccnc2)cn1 |
| InChI | InChI=1S/C15H21N5O3/c1-12(10-20-6-5-16-11-20)18-15(21)19-13-3-4-14(17-9-13)23-8-7-22-2/h3-6,9,11-12H,7-8,10H2,1-2H3,(H2,18,19,21)/t12-/m0/s1 |
| InChIKey | QSEDVDVRBPBNAP-LBPRGKRZSA-N |
| XLogP | 1.51 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|