C17H28N4O3 — CID 95772217
1-[6-(2-methoxyethoxy)-3-pyridinyl]-3-[(2R)-1-pyrrolidin-1-ylbutan-2-yl]urea (PubChem CID 95772217) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-[6-(2-methoxyethoxy)-3-pyridinyl]-3-[(2R)-1-pyrrolidin-1-ylbutan-2-yl]urea.
| Compound Name | 1-[6-(2-methoxyethoxy)-3-pyridinyl]-3-[(2R)-1-pyrrolidin-1-ylbutan-2-yl]urea |
|---|---|
| PubChem CID | 95772217 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 1-[6-(2-methoxyethoxy)-3-pyridinyl]-3-[(2R)-1-pyrrolidin-1-ylbutan-2-yl]urea |
| SMILES | CC[C@H](CN1CCCC1)NC(=O)Nc1ccc(OCCOC)nc1 |
| InChI | InChI=1S/C17H28N4O3/c1-3-14(13-21-8-4-5-9-21)19-17(22)20-15-6-7-16(18-12-15)24-11-10-23-2/h6-7,12,14H,3-5,8-11,13H2,1-2H3,(H2,19,20,22)/t14-/m1/s1 |
| InChIKey | HKPSAKMCADUXIJ-CQSZACIVSA-N |
| XLogP | 2.10 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|