C15H22N4O4 — CID 95158166
(3S)-3-N-[6-(2-methoxyethoxy)-3-pyridinyl]piperidine-1,3-dicarboxamide (PubChem CID 95158166) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is (3S)-3-N-[6-(2-methoxyethoxy)-3-pyridinyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-[6-(2-methoxyethoxy)-3-pyridinyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 95158166 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (3S)-3-N-[6-(2-methoxyethoxy)-3-pyridinyl]piperidine-1,3-dicarboxamide |
| SMILES | COCCOc1ccc(NC(=O)[C@H]2CCCN(C(N)=O)C2)cn1 |
| InChI | InChI=1S/C15H22N4O4/c1-22-7-8-23-13-5-4-12(9-17-13)18-14(20)11-3-2-6-19(10-11)15(16)21/h4-5,9,11H,2-3,6-8,10H2,1H3,(H2,16,21)(H,18,20)/t11-/m0/s1 |
| InChIKey | CFTMSAFDLOSOFW-NSHDSACASA-N |
| XLogP | 0.84 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|