C26H28N4O3 — CID 55878430
1-N-(3-methylphenyl)-3-N-(6-phenylmethoxy-3-pyridinyl)piperidine-1,3-dicarboxamide (PubChem CID 55878430) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 1-N-(3-methylphenyl)-3-N-(6-phenylmethoxy-3-pyridinyl)piperidine-1,3-dicarboxamide.
| Compound Name | 1-N-(3-methylphenyl)-3-N-(6-phenylmethoxy-3-pyridinyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 55878430 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 1-N-(3-methylphenyl)-3-N-(6-phenylmethoxy-3-pyridinyl)piperidine-1,3-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCCC(C(=O)Nc3ccc(OCc4ccccc4)nc3)C2)c1 |
| InChI | InChI=1S/C26H28N4O3/c1-19-7-5-11-22(15-19)29-26(32)30-14-6-10-21(17-30)25(31)28-23-12-13-24(27-16-23)33-18-20-8-3-2-4-9-20/h2-5,7-9,11-13,15-16,21H,6,10,14,17-18H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | FIFNVVZIBJZTOB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |