C24H29N3O2 — CID 55820118
3-N-benzyl-3-N-cyclopropyl-1-N-(3-methylphenyl)piperidine-1,3-dicarboxamide (PubChem CID 55820118) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 3-N-benzyl-3-N-cyclopropyl-1-N-(3-methylphenyl)piperidine-1,3-dicarboxamide.
| Compound Name | 3-N-benzyl-3-N-cyclopropyl-1-N-(3-methylphenyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 55820118 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 3-N-benzyl-3-N-cyclopropyl-1-N-(3-methylphenyl)piperidine-1,3-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCCC(C(=O)N(Cc3ccccc3)C3CC3)C2)c1 |
| InChI | InChI=1S/C24H29N3O2/c1-18-7-5-11-21(15-18)25-24(29)26-14-6-10-20(17-26)23(28)27(22-12-13-22)16-19-8-3-2-4-9-19/h2-5,7-9,11,15,20,22H,6,10,12-14,16-17H2,1H3,(H,25,29) |
| InChIKey | NVMZQSORGMRDNR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |