C26H27N3O3 — CID 52663493
(3R)-1-N-(3-methylphenyl)-3-N-(2-phenoxyphenyl)piperidine-1,3-dicarboxamide (PubChem CID 52663493) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is (3R)-1-N-(3-methylphenyl)-3-N-(2-phenoxyphenyl)piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-1-N-(3-methylphenyl)-3-N-(2-phenoxyphenyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 52663493 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (3R)-1-N-(3-methylphenyl)-3-N-(2-phenoxyphenyl)piperidine-1,3-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCC[C@@H](C(=O)Nc3ccccc3Oc3ccccc3)C2)c1 |
| InChI | InChI=1S/C26H27N3O3/c1-19-9-7-11-21(17-19)27-26(31)29-16-8-10-20(18-29)25(30)28-23-14-5-6-15-24(23)32-22-12-3-2-4-13-22/h2-7,9,11-15,17,20H,8,10,16,18H2,1H3,(H,27,31)(H,28,30)/t20-/m1/s1 |
| InChIKey | AENVFYZWHNNPEJ-HXUWFJFHSA-N |
| XLogP | 5.67 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |