C25H32N4O2 — CID 51962441
(3R)-1-N-(3-methylphenyl)-3-N-(2-methyl-4-pyrrolidin-1-ylphenyl)piperidine-1,3-dicarboxamide (PubChem CID 51962441) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is (3R)-1-N-(3-methylphenyl)-3-N-(2-methyl-4-pyrrolidin-1-ylphenyl)piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-1-N-(3-methylphenyl)-3-N-(2-methyl-4-pyrrolidin-1-ylphenyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 51962441 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | (3R)-1-N-(3-methylphenyl)-3-N-(2-methyl-4-pyrrolidin-1-ylphenyl)piperidine-1,3-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCC[C@@H](C(=O)Nc3ccc(N4CCCC4)cc3C)C2)c1 |
| InChI | InChI=1S/C25H32N4O2/c1-18-7-5-9-21(15-18)26-25(31)29-14-6-8-20(17-29)24(30)27-23-11-10-22(16-19(23)2)28-12-3-4-13-28/h5,7,9-11,15-16,20H,3-4,6,8,12-14,17H2,1-2H3,(H,26,31)(H,27,30)/t20-/m1/s1 |
| InChIKey | HPAJECCWNNSMHA-HXUWFJFHSA-N |
| XLogP | 4.79 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|