C26H27N3O3 — CID 60541262
1-N-(3-methylphenyl)-4-N-(2-phenoxyphenyl)piperidine-1,4-dicarboxamide (PubChem CID 60541262) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is 1-N-(3-methylphenyl)-4-N-(2-phenoxyphenyl)piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-(3-methylphenyl)-4-N-(2-phenoxyphenyl)piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 60541262 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 1-N-(3-methylphenyl)-4-N-(2-phenoxyphenyl)piperidine-1,4-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCC(C(=O)Nc3ccccc3Oc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C26H27N3O3/c1-19-8-7-9-21(18-19)27-26(31)29-16-14-20(15-17-29)25(30)28-23-12-5-6-13-24(23)32-22-10-3-2-4-11-22/h2-13,18,20H,14-17H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | PQZJBLVQQSLYRV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |