C14H23N3O3 — CID 61178172
(2S,3S)-2-amino-N-[6-(2-methoxyethoxy)-3-pyridinyl]-3-methylpentanamide (PubChem CID 61178172) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is (2S,3S)-2-amino-N-[6-(2-methoxyethoxy)-3-pyridinyl]-3-methylpentanamide.
| Compound Name | (2S,3S)-2-amino-N-[6-(2-methoxyethoxy)-3-pyridinyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 61178172 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | (2S,3S)-2-amino-N-[6-(2-methoxyethoxy)-3-pyridinyl]-3-methylpentanamide |
| SMILES | CC[C@H](C)[C@H](N)C(=O)Nc1ccc(OCCOC)nc1 |
| InChI | InChI=1S/C14H23N3O3/c1-4-10(2)13(15)14(18)17-11-5-6-12(16-9-11)20-8-7-19-3/h5-6,9-10,13H,4,7-8,15H2,1-3H3,(H,17,18)/t10-,13-/m0/s1 |
| InChIKey | PITSRYZNGFWHDU-GWCFXTLKSA-N |
| XLogP | 1.42 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|