C17H25N5O3 — CID 78879671
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[6-(2-methoxyethoxy)-3-pyridinyl]urea (PubChem CID 78879671) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[6-(2-methoxyethoxy)-3-pyridinyl]urea.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[6-(2-methoxyethoxy)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 78879671 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[6-(2-methoxyethoxy)-3-pyridinyl]urea |
| SMILES | COCCOc1ccc(NC(=O)NCCCn2nc(C)cc2C)cn1 |
| InChI | InChI=1S/C17H25N5O3/c1-13-11-14(2)22(21-13)8-4-7-18-17(23)20-15-5-6-16(19-12-15)25-10-9-24-3/h5-6,11-12H,4,7-10H2,1-3H3,(H2,18,20,23) |
| InChIKey | MLXVZAFCFIKXAV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|