C16H30N4O2 — CID 78880670
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[3-(2-methylpropoxy)propyl]urea (PubChem CID 78880670) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[3-(2-methylpropoxy)propyl]urea.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[3-(2-methylpropoxy)propyl]urea |
|---|---|
| PubChem CID | 78880670 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[3-(2-methylpropoxy)propyl]urea |
| SMILES | Cc1cc(C)n(CCCNC(=O)NCCCOCC(C)C)n1 |
| InChI | InChI=1S/C16H30N4O2/c1-13(2)12-22-10-6-8-18-16(21)17-7-5-9-20-15(4)11-14(3)19-20/h11,13H,5-10,12H2,1-4H3,(H2,17,18,21) |
| InChIKey | UDPQQDXREYDIHU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|