C12H19ClN4O2 — CID 114538986
2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]propanamide (PubChem CID 114538986) has the molecular formula C12H19ClN4O2 and a molecular weight of 286.76 g/mol. Its IUPAC name is 2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]propanamide.
| Compound Name | 2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]propanamide |
|---|---|
| PubChem CID | 114538986 |
| Molecular Formula | C12H19ClN4O2 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoyl]propanamide |
| SMILES | Cc1cc(C)n(CCCNC(=O)NC(=O)C(C)Cl)n1 |
| InChI | InChI=1S/C12H19ClN4O2/c1-8-7-9(2)17(16-8)6-4-5-14-12(19)15-11(18)10(3)13/h7,10H,4-6H2,1-3H3,(H2,14,15,18,19) |
| InChIKey | VWAJDSLJUWPSKW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|