C14H26N4O — CID 115750968
2-amino-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3,3-dimethylbutanamide (PubChem CID 115750968) has the molecular formula C14H26N4O and a molecular weight of 266.39 g/mol. Its IUPAC name is 2-amino-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3,3-dimethylbutanamide.
| Compound Name | 2-amino-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 115750968 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 2-amino-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3,3-dimethylbutanamide |
| SMILES | Cc1cc(C)n(CCCNC(=O)C(N)C(C)(C)C)n1 |
| InChI | InChI=1S/C14H26N4O/c1-10-9-11(2)18(17-10)8-6-7-16-13(19)12(15)14(3,4)5/h9,12H,6-8,15H2,1-5H3,(H,16,19) |
| InChIKey | MCEJQOURHJKDNJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|