C15H26N4O — CID 19575124
1-cyclohexyl-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]urea (PubChem CID 19575124) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-cyclohexyl-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]urea.
| Compound Name | 1-cyclohexyl-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 19575124 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 1-cyclohexyl-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]urea |
| SMILES | Cc1cc(C)n(CCCNC(=O)NC2CCCCC2)n1 |
| InChI | InChI=1S/C15H26N4O/c1-12-11-13(2)19(18-12)10-6-9-16-15(20)17-14-7-4-3-5-8-14/h11,14H,3-10H2,1-2H3,(H2,16,17,20) |
| InChIKey | TUJPYFNZFUUOHF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|