C21H31N5O3S — CID 78880674
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]urea (PubChem CID 78880674) has the molecular formula C21H31N5O3S and a molecular weight of 433.58 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]urea.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]urea |
|---|---|
| PubChem CID | 78880674 |
| Molecular Formula | C21H31N5O3S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]urea |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(NC(=O)NCCCn3nc(C)cc3C)CC2)cc1 |
| InChI | InChI=1S/C21H31N5O3S/c1-16-5-7-20(8-6-16)30(28,29)25-13-9-19(10-14-25)23-21(27)22-11-4-12-26-18(3)15-17(2)24-26/h5-8,15,19H,4,9-14H2,1-3H3,(H2,22,23,27) |
| InChIKey | MLKRMJGHLKVYAV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|